C15H16F2N4O — CID 166257159
3-[4-[6-(difluoromethyl)pyrimidin-4-yl]piperazin-1-yl]phenol (PubChem CID 166257159) has the molecular formula C15H16F2N4O and a molecular weight of 306.32 g/mol. Its IUPAC name is 3-[4-[6-(difluoromethyl)pyrimidin-4-yl]piperazin-1-yl]phenol.
| Compound Name | 3-[4-[6-(difluoromethyl)pyrimidin-4-yl]piperazin-1-yl]phenol |
|---|---|
| PubChem CID | 166257159 |
| Molecular Formula | C15H16F2N4O |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | 3-[4-[6-(difluoromethyl)pyrimidin-4-yl]piperazin-1-yl]phenol |
| SMILES | Oc1cccc(N2CCN(c3cc(C(F)F)ncn3)CC2)c1 |
| InChI | InChI=1S/C15H16F2N4O/c16-15(17)13-9-14(19-10-18-13)21-6-4-20(5-7-21)11-2-1-3-12(22)8-11/h1-3,8-10,15,22H,4-7H2 |
| InChIKey | AWBTXELGQINVFY-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |