C19H22F3N5 — CID 122282293
4-pyrrolidin-1-yl-6-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]pyrimidine (PubChem CID 122282293) has the molecular formula C19H22F3N5 and a molecular weight of 377.41 g/mol. Its IUPAC name is 4-pyrrolidin-1-yl-6-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]pyrimidine.
| Compound Name | 4-pyrrolidin-1-yl-6-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]pyrimidine |
|---|---|
| PubChem CID | 122282293 |
| Molecular Formula | C19H22F3N5 |
| Molecular Weight | 377.41 g/mol |
| Exact Mass | 377.18 |
| IUPAC Name | 4-pyrrolidin-1-yl-6-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]pyrimidine |
| SMILES | FC(F)(F)c1cccc(N2CCN(c3cc(N4CCCC4)ncn3)CC2)c1 |
| InChI | InChI=1S/C19H22F3N5/c20-19(21,22)15-4-3-5-16(12-15)25-8-10-27(11-9-25)18-13-17(23-14-24-18)26-6-1-2-7-26/h3-5,12-14H,1-2,6-11H2 |
| InChIKey | ISAXJCGGXCTUIP-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 35.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.41 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |