C21H18ClF3N4 — CID 4299131
5-(4-chlorophenyl)-2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]pyrimidine (PubChem CID 4299131) has the molecular formula C21H18ClF3N4 and a molecular weight of 418.85 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]pyrimidine.
| Compound Name | 5-(4-chlorophenyl)-2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]pyrimidine |
|---|---|
| PubChem CID | 4299131 |
| Molecular Formula | C21H18ClF3N4 |
| Molecular Weight | 418.85 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | 5-(4-chlorophenyl)-2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]pyrimidine |
| SMILES | FC(F)(F)c1cccc(N2CCN(c3ncc(-c4ccc(Cl)cc4)cn3)CC2)c1 |
| InChI | InChI=1S/C21H18ClF3N4/c22-18-6-4-15(5-7-18)16-13-26-20(27-14-16)29-10-8-28(9-11-29)19-3-1-2-17(12-19)21(23,24)25/h1-7,12-14H,8-11H2 |
| InChIKey | YPNJWJBMOSPVJE-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.85 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |