C26H28ClF3N4 — CID 11648823
4-(4-chlorophenyl)-N-[4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]butyl]pyridin-2-amine (PubChem CID 11648823) has the molecular formula C26H28ClF3N4 and a molecular weight of 488.99 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-N-[4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]butyl]pyridin-2-amine.
| Compound Name | 4-(4-chlorophenyl)-N-[4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]butyl]pyridin-2-amine |
|---|---|
| PubChem CID | 11648823 |
| Molecular Formula | C26H28ClF3N4 |
| Molecular Weight | 488.99 g/mol |
| Exact Mass | 488.20 |
| IUPAC Name | 4-(4-chlorophenyl)-N-[4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]butyl]pyridin-2-amine |
| SMILES | FC(F)(F)c1cccc(N2CCN(CCCCNc3cc(-c4ccc(Cl)cc4)ccn3)CC2)c1 |
| InChI | InChI=1S/C26H28ClF3N4/c27-23-8-6-20(7-9-23)21-10-12-32-25(18-21)31-11-1-2-13-33-14-16-34(17-15-33)24-5-3-4-22(19-24)26(28,29)30/h3-10,12,18-19H,1-2,11,13-17H2,(H,31,32) |
| InChIKey | LCNBIGUISVZSJF-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 31.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.99 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|