C19H29F3IN5 — CID 110925323
N-[4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]butyl]-1,4,5,6-tetrahydropyrimidin-2-amine;hydroiodide (PubChem CID 110925323) has the molecular formula C19H29F3IN5 and a molecular weight of 511.37 g/mol. Its IUPAC name is N-[4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]butyl]-1,4,5,6-tetrahydropyrimidin-2-amine;hydroiodide.
| Compound Name | N-[4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]butyl]-1,4,5,6-tetrahydropyrimidin-2-amine;hydroiodide |
|---|---|
| PubChem CID | 110925323 |
| Molecular Formula | C19H29F3IN5 |
| Molecular Weight | 511.37 g/mol |
| Exact Mass | 511.14 |
| IUPAC Name | N-[4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]butyl]-1,4,5,6-tetrahydropyrimidin-2-amine;hydroiodide |
| SMILES | FC(F)(F)c1cccc(N2CCN(CCCCNC3=NCCCN3)CC2)c1.I |
| InChI | InChI=1S/C19H28F3N5.HI/c20-19(21,22)16-5-3-6-17(15-16)27-13-11-26(12-14-27)10-2-1-7-23-18-24-8-4-9-25-18;/h3,5-6,15H,1-2,4,7-14H2,(H2,23,24,25);1H |
| InChIKey | SCRGRCAJKHBZES-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 42.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.37 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|