C19H31N5 — CID 110915187
N-[4-[4-(3-methylphenyl)piperazin-1-yl]butyl]-1,4,5,6-tetrahydropyrimidin-2-amine (PubChem CID 110915187) has the molecular formula C19H31N5 and a molecular weight of 329.49 g/mol. Its IUPAC name is N-[4-[4-(3-methylphenyl)piperazin-1-yl]butyl]-1,4,5,6-tetrahydropyrimidin-2-amine.
| Compound Name | N-[4-[4-(3-methylphenyl)piperazin-1-yl]butyl]-1,4,5,6-tetrahydropyrimidin-2-amine |
|---|---|
| PubChem CID | 110915187 |
| Molecular Formula | C19H31N5 |
| Molecular Weight | 329.49 g/mol |
| Exact Mass | 329.26 |
| IUPAC Name | N-[4-[4-(3-methylphenyl)piperazin-1-yl]butyl]-1,4,5,6-tetrahydropyrimidin-2-amine |
| SMILES | Cc1cccc(N2CCN(CCCCNC3=NCCCN3)CC2)c1 |
| InChI | InChI=1S/C19H31N5/c1-17-6-4-7-18(16-17)24-14-12-23(13-15-24)11-3-2-8-20-19-21-9-5-10-22-19/h4,6-7,16H,2-3,5,8-15H2,1H3,(H2,20,21,22) |
| InChIKey | YKXCLETXJSTNLJ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 42.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.49 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|