C28H43N3O — CID 112821786
3,5-dimethyl-N-[4-[4-(3-methylphenyl)piperazin-1-yl]butyl]adamantane-1-carboxamide (PubChem CID 112821786) has the molecular formula C28H43N3O and a molecular weight of 437.67 g/mol. Its IUPAC name is 3,5-dimethyl-N-[4-[4-(3-methylphenyl)piperazin-1-yl]butyl]adamantane-1-carboxamide.
| Compound Name | 3,5-dimethyl-N-[4-[4-(3-methylphenyl)piperazin-1-yl]butyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 112821786 |
| Molecular Formula | C28H43N3O |
| Molecular Weight | 437.67 g/mol |
| Exact Mass | 437.34 |
| IUPAC Name | 3,5-dimethyl-N-[4-[4-(3-methylphenyl)piperazin-1-yl]butyl]adamantane-1-carboxamide |
| SMILES | Cc1cccc(N2CCN(CCCCNC(=O)C34CC5CC(C)(CC(C)(C5)C3)C4)CC2)c1 |
| InChI | InChI=1S/C28H43N3O/c1-22-7-6-8-24(15-22)31-13-11-30(12-14-31)10-5-4-9-29-25(32)28-18-23-16-26(2,20-28)19-27(3,17-23)21-28/h6-8,15,23H,4-5,9-14,16-21H2,1-3H3,(H,29,32) |
| InChIKey | BYDDMZNANZRVEK-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.67 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|