C20H31N3O — CID 98331774
(3R,5R)-3,5-dimethyl-N-[3-(4-methylpyrazol-1-yl)propyl]adamantane-1-carboxamide (PubChem CID 98331774) has the molecular formula C20H31N3O and a molecular weight of 329.49 g/mol. Its IUPAC name is (3R,5R)-3,5-dimethyl-N-[3-(4-methylpyrazol-1-yl)propyl]adamantane-1-carboxamide.
| Compound Name | (3R,5R)-3,5-dimethyl-N-[3-(4-methylpyrazol-1-yl)propyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 98331774 |
| Molecular Formula | C20H31N3O |
| Molecular Weight | 329.49 g/mol |
| Exact Mass | 329.25 |
| IUPAC Name | (3R,5R)-3,5-dimethyl-N-[3-(4-methylpyrazol-1-yl)propyl]adamantane-1-carboxamide |
| SMILES | Cc1cnn(CCCNC(=O)C23CC4C[C@@](C)(C2)C[C@@](C)(C4)C3)c1 |
| InChI | InChI=1S/C20H31N3O/c1-15-10-22-23(11-15)6-4-5-21-17(24)20-9-16-7-18(2,13-20)12-19(3,8-16)14-20/h10-11,16H,4-9,12-14H2,1-3H3,(H,21,24)/t16?,18-,19-,20?/m1/s1 |
| InChIKey | UQEQXQBGLLZSOW-CGIJZDBUSA-N |
| XLogP | 3.69 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.49 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|