C22H36N2O2 — CID 112767661
3,5-dimethyl-N-[3-(2-oxoazepan-1-yl)propyl]adamantane-1-carboxamide (PubChem CID 112767661) has the molecular formula C22H36N2O2 and a molecular weight of 360.54 g/mol. Its IUPAC name is 3,5-dimethyl-N-[3-(2-oxoazepan-1-yl)propyl]adamantane-1-carboxamide.
| Compound Name | 3,5-dimethyl-N-[3-(2-oxoazepan-1-yl)propyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 112767661 |
| Molecular Formula | C22H36N2O2 |
| Molecular Weight | 360.54 g/mol |
| Exact Mass | 360.28 |
| IUPAC Name | 3,5-dimethyl-N-[3-(2-oxoazepan-1-yl)propyl]adamantane-1-carboxamide |
| SMILES | CC12CC3CC(C)(C1)CC(C(=O)NCCCN1CCCCCC1=O)(C3)C2 |
| InChI | InChI=1S/C22H36N2O2/c1-20-11-17-12-21(2,14-20)16-22(13-17,15-20)19(26)23-8-6-10-24-9-5-3-4-7-18(24)25/h17H,3-16H2,1-2H3,(H,23,26) |
| InChIKey | SHCHCFGNTDZVDT-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.54 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|