C25H47N3O3 — CID 162874542
N-[4-(13,21-dioxo-1,5-diazacyclohenicos-1-yl)butyl]acetamide (PubChem CID 162874542) has the molecular formula C25H47N3O3 and a molecular weight of 437.67 g/mol. Its IUPAC name is N-[4-(13,21-dioxo-1,5-diazacyclohenicos-1-yl)butyl]acetamide.
| Compound Name | N-[4-(13,21-dioxo-1,5-diazacyclohenicos-1-yl)butyl]acetamide |
|---|---|
| PubChem CID | 162874542 |
| Molecular Formula | C25H47N3O3 |
| Molecular Weight | 437.67 g/mol |
| Exact Mass | 437.36 |
| IUPAC Name | N-[4-(13,21-dioxo-1,5-diazacyclohenicos-1-yl)butyl]acetamide |
| SMILES | CC(=O)NCCCCN1CCCNCCCCCCCC(=O)CCCCCCCC1=O |
| InChI | InChI=1S/C25H47N3O3/c1-23(29)27-20-12-13-21-28-22-14-19-26-18-11-7-3-5-9-16-24(30)15-8-4-2-6-10-17-25(28)31/h26H,2-22H2,1H3,(H,27,29) |
| InChIKey | JLNUPMKXYKJDRQ-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.67 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|