C17H31ClN2O — CID 119430118
3,5-dimethyl-N-[3-(methylamino)propyl]adamantane-1-carboxamide;hydrochloride (PubChem CID 119430118) has the molecular formula C17H31ClN2O and a molecular weight of 314.90 g/mol. Its IUPAC name is 3,5-dimethyl-N-[3-(methylamino)propyl]adamantane-1-carboxamide;hydrochloride.
| Compound Name | 3,5-dimethyl-N-[3-(methylamino)propyl]adamantane-1-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119430118 |
| Molecular Formula | C17H31ClN2O |
| Molecular Weight | 314.90 g/mol |
| Exact Mass | 314.21 |
| IUPAC Name | 3,5-dimethyl-N-[3-(methylamino)propyl]adamantane-1-carboxamide;hydrochloride |
| SMILES | CNCCCNC(=O)C12CC3CC(C)(CC(C)(C3)C1)C2.Cl |
| InChI | InChI=1S/C17H30N2O.ClH/c1-15-7-13-8-16(2,10-15)12-17(9-13,11-15)14(20)19-6-4-5-18-3;/h13,18H,4-12H2,1-3H3,(H,19,20);1H |
| InChIKey | BSPNBSOLZIWHNR-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.90 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|