C23H32N2O3 — CID 112846085
N-[2-[(4-methoxybenzoyl)amino]ethyl]-3,5-dimethyladamantane-1-carboxamide (PubChem CID 112846085) has the molecular formula C23H32N2O3 and a molecular weight of 384.52 g/mol. Its IUPAC name is N-[2-[(4-methoxybenzoyl)amino]ethyl]-3,5-dimethyladamantane-1-carboxamide.
| Compound Name | N-[2-[(4-methoxybenzoyl)amino]ethyl]-3,5-dimethyladamantane-1-carboxamide |
|---|---|
| PubChem CID | 112846085 |
| Molecular Formula | C23H32N2O3 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.24 |
| IUPAC Name | N-[2-[(4-methoxybenzoyl)amino]ethyl]-3,5-dimethyladamantane-1-carboxamide |
| SMILES | COc1ccc(C(=O)NCCNC(=O)C23CC4CC(C)(CC(C)(C4)C2)C3)cc1 |
| InChI | InChI=1S/C23H32N2O3/c1-21-10-16-11-22(2,13-21)15-23(12-16,14-21)20(27)25-9-8-24-19(26)17-4-6-18(28-3)7-5-17/h4-7,16H,8-15H2,1-3H3,(H,24,26)(H,25,27) |
| InChIKey | FYBQQXUMCSFSHM-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|