C23H33NO4 — CID 112837522
3,5-dimethyl-N-[(2,4,6-trimethoxyphenyl)methyl]adamantane-1-carboxamide (PubChem CID 112837522) has the molecular formula C23H33NO4 and a molecular weight of 387.52 g/mol. Its IUPAC name is 3,5-dimethyl-N-[(2,4,6-trimethoxyphenyl)methyl]adamantane-1-carboxamide.
| Compound Name | 3,5-dimethyl-N-[(2,4,6-trimethoxyphenyl)methyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 112837522 |
| Molecular Formula | C23H33NO4 |
| Molecular Weight | 387.52 g/mol |
| Exact Mass | 387.24 |
| IUPAC Name | 3,5-dimethyl-N-[(2,4,6-trimethoxyphenyl)methyl]adamantane-1-carboxamide |
| SMILES | COc1cc(OC)c(CNC(=O)C23CC4CC(C)(CC(C)(C4)C2)C3)c(OC)c1 |
| InChI | InChI=1S/C23H33NO4/c1-21-8-15-9-22(2,12-21)14-23(10-15,13-21)20(25)24-11-17-18(27-4)6-16(26-3)7-19(17)28-5/h6-7,15H,8-14H2,1-5H3,(H,24,25) |
| InChIKey | XORZETOIBLXZNM-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.52 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |