C21H29NO4 — CID 87006790
N-[(2,4,6-trimethoxyphenyl)methyl]adamantane-2-carboxamide (PubChem CID 87006790) has the molecular formula C21H29NO4 and a molecular weight of 359.47 g/mol. Its IUPAC name is N-[(2,4,6-trimethoxyphenyl)methyl]adamantane-2-carboxamide.
| Compound Name | N-[(2,4,6-trimethoxyphenyl)methyl]adamantane-2-carboxamide |
|---|---|
| PubChem CID | 87006790 |
| Molecular Formula | C21H29NO4 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.21 |
| IUPAC Name | N-[(2,4,6-trimethoxyphenyl)methyl]adamantane-2-carboxamide |
| SMILES | COc1cc(OC)c(CNC(=O)C2C3CC4CC(C3)CC2C4)c(OC)c1 |
| InChI | InChI=1S/C21H29NO4/c1-24-16-9-18(25-2)17(19(10-16)26-3)11-22-21(23)20-14-5-12-4-13(7-14)8-15(20)6-12/h9-10,12-15,20H,4-8,11H2,1-3H3,(H,22,23) |
| InChIKey | LEHOAGSUNHVHKS-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |