C19H26N2O — CID 6468967
3,5-dimethyl-N-(pyridin-3-ylmethyl)adamantane-1-carboxamide (PubChem CID 6468967) has the molecular formula C19H26N2O and a molecular weight of 298.43 g/mol. Its IUPAC name is 3,5-dimethyl-N-(pyridin-3-ylmethyl)adamantane-1-carboxamide.
| Compound Name | 3,5-dimethyl-N-(pyridin-3-ylmethyl)adamantane-1-carboxamide |
|---|---|
| PubChem CID | 6468967 |
| Molecular Formula | C19H26N2O |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.20 |
| IUPAC Name | 3,5-dimethyl-N-(pyridin-3-ylmethyl)adamantane-1-carboxamide |
| SMILES | CC12CC3CC(C)(C1)CC(C(=O)NCc1cccnc1)(C3)C2 |
| InChI | InChI=1S/C19H26N2O/c1-17-6-15-7-18(2,11-17)13-19(8-15,12-17)16(22)21-10-14-4-3-5-20-9-14/h3-5,9,15H,6-8,10-13H2,1-2H3,(H,21,22) |
| InChIKey | BMOXTRDXGVCHJL-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |