C27H31F3N4 — CID 71187765
4-(4-methylphenyl)-N-[4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]butyl]pyridin-2-amine (PubChem CID 71187765) has the molecular formula C27H31F3N4 and a molecular weight of 468.57 g/mol. Its IUPAC name is 4-(4-methylphenyl)-N-[4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]butyl]pyridin-2-amine.
| Compound Name | 4-(4-methylphenyl)-N-[4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]butyl]pyridin-2-amine |
|---|---|
| PubChem CID | 71187765 |
| Molecular Formula | C27H31F3N4 |
| Molecular Weight | 468.57 g/mol |
| Exact Mass | 468.25 |
| IUPAC Name | 4-(4-methylphenyl)-N-[4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]butyl]pyridin-2-amine |
| SMILES | Cc1ccc(-c2ccnc(NCCCCN3CCN(c4cccc(C(F)(F)F)c4)CC3)c2)cc1 |
| InChI | InChI=1S/C27H31F3N4/c1-21-7-9-22(10-8-21)23-11-13-32-26(19-23)31-12-2-3-14-33-15-17-34(18-16-33)25-6-4-5-24(20-25)27(28,29)30/h4-11,13,19-20H,2-3,12,14-18H2,1H3,(H,31,32) |
| InChIKey | PVTYCSAAAWTPBJ-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 31.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.57 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|