C19H21F3N6 — CID 71934202
3-[3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]propylamino]pyrazine-2-carbonitrile (PubChem CID 71934202) has the molecular formula C19H21F3N6 and a molecular weight of 390.41 g/mol. Its IUPAC name is 3-[3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]propylamino]pyrazine-2-carbonitrile.
| Compound Name | 3-[3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]propylamino]pyrazine-2-carbonitrile |
|---|---|
| PubChem CID | 71934202 |
| Molecular Formula | C19H21F3N6 |
| Molecular Weight | 390.41 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | 3-[3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]propylamino]pyrazine-2-carbonitrile |
| SMILES | N#Cc1nccnc1NCCCN1CCN(c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C19H21F3N6/c20-19(21,22)15-3-1-4-16(13-15)28-11-9-27(10-12-28)8-2-5-25-18-17(14-23)24-6-7-26-18/h1,3-4,6-7,13H,2,5,8-12H2,(H,25,26) |
| InChIKey | KYOYUBGCVDNAHW-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 68.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.41 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|