C27H36Cl2N4 — CID 162306694
N-[4-[4-(2,3-dimethylphenyl)piperazin-1-yl]butyl]-4-phenylpyridin-2-amine;dihydrochloride (PubChem CID 162306694) has the molecular formula C27H36Cl2N4 and a molecular weight of 487.52 g/mol. Its IUPAC name is N-[4-[4-(2,3-dimethylphenyl)piperazin-1-yl]butyl]-4-phenylpyridin-2-amine;dihydrochloride.
| Compound Name | N-[4-[4-(2,3-dimethylphenyl)piperazin-1-yl]butyl]-4-phenylpyridin-2-amine;dihydrochloride |
|---|---|
| PubChem CID | 162306694 |
| Molecular Formula | C27H36Cl2N4 |
| Molecular Weight | 487.52 g/mol |
| Exact Mass | 486.23 |
| IUPAC Name | N-[4-[4-(2,3-dimethylphenyl)piperazin-1-yl]butyl]-4-phenylpyridin-2-amine;dihydrochloride |
| SMILES | Cc1cccc(N2CCN(CCCCNc3cc(-c4ccccc4)ccn3)CC2)c1C.Cl.Cl |
| InChI | InChI=1S/C27H34N4.2ClH/c1-22-9-8-12-26(23(22)2)31-19-17-30(18-20-31)16-7-6-14-28-27-21-25(13-15-29-27)24-10-4-3-5-11-24;;/h3-5,8-13,15,21H,6-7,14,16-20H2,1-2H3,(H,28,29);2*1H |
| InChIKey | FCEUVIZPBRTCPY-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 31.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.52 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|