C33H39N5O — CID 67495094
N-[3-[4-(2,3-dimethylphenyl)piperazin-1-yl]propyl]-5-methyl-1-(4-methylphenyl)-2-phenylimidazole-4-carboxamide (PubChem CID 67495094) has the molecular formula C33H39N5O and a molecular weight of 521.71 g/mol. Its IUPAC name is N-[3-[4-(2,3-dimethylphenyl)piperazin-1-yl]propyl]-5-methyl-1-(4-methylphenyl)-2-phenylimidazole-4-carboxamide.
| Compound Name | N-[3-[4-(2,3-dimethylphenyl)piperazin-1-yl]propyl]-5-methyl-1-(4-methylphenyl)-2-phenylimidazole-4-carboxamide |
|---|---|
| PubChem CID | 67495094 |
| Molecular Formula | C33H39N5O |
| Molecular Weight | 521.71 g/mol |
| Exact Mass | 521.32 |
| IUPAC Name | N-[3-[4-(2,3-dimethylphenyl)piperazin-1-yl]propyl]-5-methyl-1-(4-methylphenyl)-2-phenylimidazole-4-carboxamide |
| SMILES | Cc1ccc(-n2c(-c3ccccc3)nc(C(=O)NCCCN3CCN(c4cccc(C)c4C)CC3)c2C)cc1 |
| InChI | InChI=1S/C33H39N5O/c1-24-14-16-29(17-15-24)38-27(4)31(35-32(38)28-11-6-5-7-12-28)33(39)34-18-9-19-36-20-22-37(23-21-36)30-13-8-10-25(2)26(30)3/h5-8,10-17H,9,18-23H2,1-4H3,(H,34,39) |
| InChIKey | QTNNEIPWZUBNHI-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.71 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|