C27H37Cl2N5O — CID 54576800
N-[3-[4-(2,3-dimethylphenyl)piperazin-1-yl]propyl]-2,5-dimethyl-1-phenylimidazole-4-carboxamide;dihydrochloride (PubChem CID 54576800) has the molecular formula C27H37Cl2N5O and a molecular weight of 518.53 g/mol. Its IUPAC name is N-[3-[4-(2,3-dimethylphenyl)piperazin-1-yl]propyl]-2,5-dimethyl-1-phenylimidazole-4-carboxamide;dihydrochloride.
| Compound Name | N-[3-[4-(2,3-dimethylphenyl)piperazin-1-yl]propyl]-2,5-dimethyl-1-phenylimidazole-4-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 54576800 |
| Molecular Formula | C27H37Cl2N5O |
| Molecular Weight | 518.53 g/mol |
| Exact Mass | 517.24 |
| IUPAC Name | N-[3-[4-(2,3-dimethylphenyl)piperazin-1-yl]propyl]-2,5-dimethyl-1-phenylimidazole-4-carboxamide;dihydrochloride |
| SMILES | Cc1cccc(N2CCN(CCCNC(=O)c3nc(C)n(-c4ccccc4)c3C)CC2)c1C.Cl.Cl |
| InChI | InChI=1S/C27H35N5O.2ClH/c1-20-10-8-13-25(21(20)2)31-18-16-30(17-19-31)15-9-14-28-27(33)26-22(3)32(23(4)29-26)24-11-6-5-7-12-24;;/h5-8,10-13H,9,14-19H2,1-4H3,(H,28,33);2*1H |
| InChIKey | SVYQLZGVECCISN-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.53 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|