C29H38FN5O — CID 66899060
N-[3-[4-(2,3-dimethylphenyl)piperazin-1-yl]propyl]-1-(2-fluorophenyl)-5-methyl-2-propylimidazole-4-carboxamide (PubChem CID 66899060) has the molecular formula C29H38FN5O and a molecular weight of 491.66 g/mol. Its IUPAC name is N-[3-[4-(2,3-dimethylphenyl)piperazin-1-yl]propyl]-1-(2-fluorophenyl)-5-methyl-2-propylimidazole-4-carboxamide.
| Compound Name | N-[3-[4-(2,3-dimethylphenyl)piperazin-1-yl]propyl]-1-(2-fluorophenyl)-5-methyl-2-propylimidazole-4-carboxamide |
|---|---|
| PubChem CID | 66899060 |
| Molecular Formula | C29H38FN5O |
| Molecular Weight | 491.66 g/mol |
| Exact Mass | 491.31 |
| IUPAC Name | N-[3-[4-(2,3-dimethylphenyl)piperazin-1-yl]propyl]-1-(2-fluorophenyl)-5-methyl-2-propylimidazole-4-carboxamide |
| SMILES | CCCc1nc(C(=O)NCCCN2CCN(c3cccc(C)c3C)CC2)c(C)n1-c1ccccc1F |
| InChI | InChI=1S/C29H38FN5O/c1-5-10-27-32-28(23(4)35(27)26-13-7-6-12-24(26)30)29(36)31-15-9-16-33-17-19-34(20-18-33)25-14-8-11-21(2)22(25)3/h6-8,11-14H,5,9-10,15-20H2,1-4H3,(H,31,36) |
| InChIKey | HZIIOLXQHOENGR-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.66 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|