C31H33Cl2N5O2 — CID 54576586
N-[3-[4-(2,3-dichlorophenyl)piperazin-1-yl]propyl]-1-(4-methoxyphenyl)-5-methyl-2-phenylimidazole-4-carboxamide (PubChem CID 54576586) has the molecular formula C31H33Cl2N5O2 and a molecular weight of 578.54 g/mol. Its IUPAC name is N-[3-[4-(2,3-dichlorophenyl)piperazin-1-yl]propyl]-1-(4-methoxyphenyl)-5-methyl-2-phenylimidazole-4-carboxamide.
| Compound Name | N-[3-[4-(2,3-dichlorophenyl)piperazin-1-yl]propyl]-1-(4-methoxyphenyl)-5-methyl-2-phenylimidazole-4-carboxamide |
|---|---|
| PubChem CID | 54576586 |
| Molecular Formula | C31H33Cl2N5O2 |
| Molecular Weight | 578.54 g/mol |
| Exact Mass | 577.20 |
| IUPAC Name | N-[3-[4-(2,3-dichlorophenyl)piperazin-1-yl]propyl]-1-(4-methoxyphenyl)-5-methyl-2-phenylimidazole-4-carboxamide |
| SMILES | COc1ccc(-n2c(-c3ccccc3)nc(C(=O)NCCCN3CCN(c4cccc(Cl)c4Cl)CC3)c2C)cc1 |
| InChI | InChI=1S/C31H33Cl2N5O2/c1-22-29(35-30(23-8-4-3-5-9-23)38(22)24-12-14-25(40-2)15-13-24)31(39)34-16-7-17-36-18-20-37(21-19-36)27-11-6-10-26(32)28(27)33/h3-6,8-15H,7,16-21H2,1-2H3,(H,34,39) |
| InChIKey | VRIQCARJLNVYOS-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 62.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.54 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|