C27H34Cl2N6O2 — CID 11512263
N-[5-[4-(2,3-dichlorophenyl)piperazin-1-yl]pentyl]-1-[(4-methoxyphenyl)methyl]-5-methyltriazole-4-carboxamide (PubChem CID 11512263) has the molecular formula C27H34Cl2N6O2 and a molecular weight of 545.52 g/mol. Its IUPAC name is N-[5-[4-(2,3-dichlorophenyl)piperazin-1-yl]pentyl]-1-[(4-methoxyphenyl)methyl]-5-methyltriazole-4-carboxamide.
| Compound Name | N-[5-[4-(2,3-dichlorophenyl)piperazin-1-yl]pentyl]-1-[(4-methoxyphenyl)methyl]-5-methyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 11512263 |
| Molecular Formula | C27H34Cl2N6O2 |
| Molecular Weight | 545.52 g/mol |
| Exact Mass | 544.21 |
| IUPAC Name | N-[5-[4-(2,3-dichlorophenyl)piperazin-1-yl]pentyl]-1-[(4-methoxyphenyl)methyl]-5-methyltriazole-4-carboxamide |
| SMILES | COc1ccc(Cn2nnc(C(=O)NCCCCCN3CCN(c4cccc(Cl)c4Cl)CC3)c2C)cc1 |
| InChI | InChI=1S/C27H34Cl2N6O2/c1-20-26(31-32-35(20)19-21-9-11-22(37-2)12-10-21)27(36)30-13-4-3-5-14-33-15-17-34(18-16-33)24-8-6-7-23(28)25(24)29/h6-12H,3-5,13-19H2,1-2H3,(H,30,36) |
| InChIKey | MWLMSEXRHBMQDW-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 75.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.52 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|