C26H30Cl2N4O2 — CID 45279481
N-[3-[4-(2,3-dichlorophenyl)piperazin-1-yl]propyl]-5-(4-methoxyphenyl)-2-methyl-1H-pyrrole-3-carboxamide (PubChem CID 45279481) has the molecular formula C26H30Cl2N4O2 and a molecular weight of 501.46 g/mol. Its IUPAC name is N-[3-[4-(2,3-dichlorophenyl)piperazin-1-yl]propyl]-5-(4-methoxyphenyl)-2-methyl-1H-pyrrole-3-carboxamide.
| Compound Name | N-[3-[4-(2,3-dichlorophenyl)piperazin-1-yl]propyl]-5-(4-methoxyphenyl)-2-methyl-1H-pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 45279481 |
| Molecular Formula | C26H30Cl2N4O2 |
| Molecular Weight | 501.46 g/mol |
| Exact Mass | 500.17 |
| IUPAC Name | N-[3-[4-(2,3-dichlorophenyl)piperazin-1-yl]propyl]-5-(4-methoxyphenyl)-2-methyl-1H-pyrrole-3-carboxamide |
| SMILES | COc1ccc(-c2cc(C(=O)NCCCN3CCN(c4cccc(Cl)c4Cl)CC3)c(C)[nH]2)cc1 |
| InChI | InChI=1S/C26H30Cl2N4O2/c1-18-21(17-23(30-18)19-7-9-20(34-2)10-8-19)26(33)29-11-4-12-31-13-15-32(16-14-31)24-6-3-5-22(27)25(24)28/h3,5-10,17,30H,4,11-16H2,1-2H3,(H,29,33) |
| InChIKey | CFRGSLOAADYGPV-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 60.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.46 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|