C33H46BrCl2N3O2 — CID 143050992
4-bromo-N-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]-1-methoxynaphthalene-2-carboxamide;ethane;pentane (PubChem CID 143050992) has the molecular formula C33H46BrCl2N3O2 and a molecular weight of 667.56 g/mol. Its IUPAC name is 4-bromo-N-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]-1-methoxynaphthalene-2-carboxamide;ethane;pentane.
| Compound Name | 4-bromo-N-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]-1-methoxynaphthalene-2-carboxamide;ethane;pentane |
|---|---|
| PubChem CID | 143050992 |
| Molecular Formula | C33H46BrCl2N3O2 |
| Molecular Weight | 667.56 g/mol |
| Exact Mass | 665.22 |
| IUPAC Name | 4-bromo-N-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]-1-methoxynaphthalene-2-carboxamide;ethane;pentane |
| SMILES | CC.CCCCC.COc1c(C(=O)NCCCCN2CCN(c3cccc(Cl)c3Cl)CC2)cc(Br)c2ccccc12 |
| InChI | InChI=1S/C26H28BrCl2N3O2.C5H12.C2H6/c1-34-25-19-8-3-2-7-18(19)21(27)17-20(25)26(33)30-11-4-5-12-31-13-15-32(16-14-31)23-10-6-9-22(28)24(23)29;1-3-5-4-2;1-2/h2-3,6-10,17H,4-5,11-16H2,1H3,(H,30,33);3-5H2,1-2H3;1-2H3 |
| InChIKey | GEXVZFPTCGGBMH-UHFFFAOYSA-N |
| XLogP | 9.47 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.56 |
| LogP ≤ 5 | 9.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|