C23H30Cl2N4O — CID 45278730
5-but-3-enyl-N-[3-[4-(2,3-dichlorophenyl)piperazin-1-yl]propyl]-2-methyl-1H-pyrrole-3-carboxamide (PubChem CID 45278730) has the molecular formula C23H30Cl2N4O and a molecular weight of 449.43 g/mol. Its IUPAC name is 5-but-3-enyl-N-[3-[4-(2,3-dichlorophenyl)piperazin-1-yl]propyl]-2-methyl-1H-pyrrole-3-carboxamide.
| Compound Name | 5-but-3-enyl-N-[3-[4-(2,3-dichlorophenyl)piperazin-1-yl]propyl]-2-methyl-1H-pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 45278730 |
| Molecular Formula | C23H30Cl2N4O |
| Molecular Weight | 449.43 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | 5-but-3-enyl-N-[3-[4-(2,3-dichlorophenyl)piperazin-1-yl]propyl]-2-methyl-1H-pyrrole-3-carboxamide |
| SMILES | C=CCCc1cc(C(=O)NCCCN2CCN(c3cccc(Cl)c3Cl)CC2)c(C)[nH]1 |
| InChI | InChI=1S/C23H30Cl2N4O/c1-3-4-7-18-16-19(17(2)27-18)23(30)26-10-6-11-28-12-14-29(15-13-28)21-9-5-8-20(24)22(21)25/h3,5,8-9,16,27H,1,4,6-7,10-15H2,2H3,(H,26,30) |
| InChIKey | HVGWWEVDXCZKIK-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 51.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.43 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|