C24H27Cl2N5O — CID 45278646
N-[3-[4-(2,3-dichlorophenyl)piperazin-1-yl]propyl]-2-methyl-5-pyridin-3-yl-1H-pyrrole-3-carboxamide (PubChem CID 45278646) has the molecular formula C24H27Cl2N5O and a molecular weight of 472.42 g/mol. Its IUPAC name is N-[3-[4-(2,3-dichlorophenyl)piperazin-1-yl]propyl]-2-methyl-5-pyridin-3-yl-1H-pyrrole-3-carboxamide.
| Compound Name | N-[3-[4-(2,3-dichlorophenyl)piperazin-1-yl]propyl]-2-methyl-5-pyridin-3-yl-1H-pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 45278646 |
| Molecular Formula | C24H27Cl2N5O |
| Molecular Weight | 472.42 g/mol |
| Exact Mass | 471.16 |
| IUPAC Name | N-[3-[4-(2,3-dichlorophenyl)piperazin-1-yl]propyl]-2-methyl-5-pyridin-3-yl-1H-pyrrole-3-carboxamide |
| SMILES | Cc1[nH]c(-c2cccnc2)cc1C(=O)NCCCN1CCN(c2cccc(Cl)c2Cl)CC1 |
| InChI | InChI=1S/C24H27Cl2N5O/c1-17-19(15-21(29-17)18-5-3-8-27-16-18)24(32)28-9-4-10-30-11-13-31(14-12-30)22-7-2-6-20(25)23(22)26/h2-3,5-8,15-16,29H,4,9-14H2,1H3,(H,28,32) |
| InChIKey | LPSVMGRZQLWORC-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 64.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.42 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|