C26H32Cl2N6O — CID 11540842
1-benzyl-N-[5-[4-(2,3-dichlorophenyl)piperazin-1-yl]pentyl]-5-methyltriazole-4-carboxamide (PubChem CID 11540842) has the molecular formula C26H32Cl2N6O and a molecular weight of 515.49 g/mol. Its IUPAC name is 1-benzyl-N-[5-[4-(2,3-dichlorophenyl)piperazin-1-yl]pentyl]-5-methyltriazole-4-carboxamide.
| Compound Name | 1-benzyl-N-[5-[4-(2,3-dichlorophenyl)piperazin-1-yl]pentyl]-5-methyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 11540842 |
| Molecular Formula | C26H32Cl2N6O |
| Molecular Weight | 515.49 g/mol |
| Exact Mass | 514.20 |
| IUPAC Name | 1-benzyl-N-[5-[4-(2,3-dichlorophenyl)piperazin-1-yl]pentyl]-5-methyltriazole-4-carboxamide |
| SMILES | Cc1c(C(=O)NCCCCCN2CCN(c3cccc(Cl)c3Cl)CC2)nnn1Cc1ccccc1 |
| InChI | InChI=1S/C26H32Cl2N6O/c1-20-25(30-31-34(20)19-21-9-4-2-5-10-21)26(35)29-13-6-3-7-14-32-15-17-33(18-16-32)23-12-8-11-22(27)24(23)28/h2,4-5,8-12H,3,6-7,13-19H2,1H3,(H,29,35) |
| InChIKey | FYHDUYJHKIWKCX-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.49 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|