C27H29Cl2N3O2 — CID 90467170
(3-phenylphenyl) N-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]carbamate (PubChem CID 90467170) has the molecular formula C27H29Cl2N3O2 and a molecular weight of 498.45 g/mol. Its IUPAC name is (3-phenylphenyl) N-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]carbamate.
| Compound Name | (3-phenylphenyl) N-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]carbamate |
|---|---|
| PubChem CID | 90467170 |
| Molecular Formula | C27H29Cl2N3O2 |
| Molecular Weight | 498.45 g/mol |
| Exact Mass | 497.16 |
| IUPAC Name | (3-phenylphenyl) N-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]carbamate |
| SMILES | O=C(NCCCCN1CCN(c2cccc(Cl)c2Cl)CC1)Oc1cccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C27H29Cl2N3O2/c28-24-12-7-13-25(26(24)29)32-18-16-31(17-19-32)15-5-4-14-30-27(33)34-23-11-6-10-22(20-23)21-8-2-1-3-9-21/h1-3,6-13,20H,4-5,14-19H2,(H,30,33) |
| InChIKey | FVDJBCOSGCFCMV-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.45 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|