C30H40N4O — CID 45279304
N-[4-[4-(2,3-dimethylphenyl)piperazin-1-yl]butyl]-1-ethyl-2-methyl-5-phenylpyrrole-3-carboxamide (PubChem CID 45279304) has the molecular formula C30H40N4O and a molecular weight of 472.68 g/mol. Its IUPAC name is N-[4-[4-(2,3-dimethylphenyl)piperazin-1-yl]butyl]-1-ethyl-2-methyl-5-phenylpyrrole-3-carboxamide.
| Compound Name | N-[4-[4-(2,3-dimethylphenyl)piperazin-1-yl]butyl]-1-ethyl-2-methyl-5-phenylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 45279304 |
| Molecular Formula | C30H40N4O |
| Molecular Weight | 472.68 g/mol |
| Exact Mass | 472.32 |
| IUPAC Name | N-[4-[4-(2,3-dimethylphenyl)piperazin-1-yl]butyl]-1-ethyl-2-methyl-5-phenylpyrrole-3-carboxamide |
| SMILES | CCn1c(-c2ccccc2)cc(C(=O)NCCCCN2CCN(c3cccc(C)c3C)CC2)c1C |
| InChI | InChI=1S/C30H40N4O/c1-5-34-25(4)27(22-29(34)26-13-7-6-8-14-26)30(35)31-16-9-10-17-32-18-20-33(21-19-32)28-15-11-12-23(2)24(28)3/h6-8,11-15,22H,5,9-10,16-21H2,1-4H3,(H,31,35) |
| InChIKey | LMEZMYVOWBRDKV-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 40.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.68 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|