C16H17F3N4 — CID 122282471
6-pyrrolidin-1-yl-N-[[3-(trifluoromethyl)phenyl]methyl]pyrimidin-4-amine (PubChem CID 122282471) has the molecular formula C16H17F3N4 and a molecular weight of 322.33 g/mol. Its IUPAC name is 6-pyrrolidin-1-yl-N-[[3-(trifluoromethyl)phenyl]methyl]pyrimidin-4-amine.
| Compound Name | 6-pyrrolidin-1-yl-N-[[3-(trifluoromethyl)phenyl]methyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 122282471 |
| Molecular Formula | C16H17F3N4 |
| Molecular Weight | 322.33 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | 6-pyrrolidin-1-yl-N-[[3-(trifluoromethyl)phenyl]methyl]pyrimidin-4-amine |
| SMILES | FC(F)(F)c1cccc(CNc2cc(N3CCCC3)ncn2)c1 |
| InChI | InChI=1S/C16H17F3N4/c17-16(18,19)13-5-3-4-12(8-13)10-20-14-9-15(22-11-21-14)23-6-1-2-7-23/h3-5,8-9,11H,1-2,6-7,10H2,(H,20,21,22) |
| InChIKey | SDKHHURUDZNRLM-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.33 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |