C24H26F3N5 — CID 67511856
6-(2-amino-5-piperidin-1-ylphenyl)-N-[2-[3-(trifluoromethyl)phenyl]ethyl]pyrimidin-4-amine (PubChem CID 67511856) has the molecular formula C24H26F3N5 and a molecular weight of 441.50 g/mol. Its IUPAC name is 6-(2-amino-5-piperidin-1-ylphenyl)-N-[2-[3-(trifluoromethyl)phenyl]ethyl]pyrimidin-4-amine.
| Compound Name | 6-(2-amino-5-piperidin-1-ylphenyl)-N-[2-[3-(trifluoromethyl)phenyl]ethyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 67511856 |
| Molecular Formula | C24H26F3N5 |
| Molecular Weight | 441.50 g/mol |
| Exact Mass | 441.21 |
| IUPAC Name | 6-(2-amino-5-piperidin-1-ylphenyl)-N-[2-[3-(trifluoromethyl)phenyl]ethyl]pyrimidin-4-amine |
| SMILES | Nc1ccc(N2CCCCC2)cc1-c1cc(NCCc2cccc(C(F)(F)F)c2)ncn1 |
| InChI | InChI=1S/C24H26F3N5/c25-24(26,27)18-6-4-5-17(13-18)9-10-29-23-15-22(30-16-31-23)20-14-19(7-8-21(20)28)32-11-2-1-3-12-32/h4-8,13-16H,1-3,9-12,28H2,(H,29,30,31) |
| InChIKey | UKSWNMVRNOFJSC-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.50 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|