C23H32N6O3 — CID 51041576
2-[[4-(2,6-dimorpholin-4-ylpyrimidin-4-yl)piperazin-1-yl]methyl]phenol (PubChem CID 51041576) has the molecular formula C23H32N6O3 and a molecular weight of 440.55 g/mol. Its IUPAC name is 2-[[4-(2,6-dimorpholin-4-ylpyrimidin-4-yl)piperazin-1-yl]methyl]phenol.
| Compound Name | 2-[[4-(2,6-dimorpholin-4-ylpyrimidin-4-yl)piperazin-1-yl]methyl]phenol |
|---|---|
| PubChem CID | 51041576 |
| Molecular Formula | C23H32N6O3 |
| Molecular Weight | 440.55 g/mol |
| Exact Mass | 440.25 |
| IUPAC Name | 2-[[4-(2,6-dimorpholin-4-ylpyrimidin-4-yl)piperazin-1-yl]methyl]phenol |
| SMILES | Oc1ccccc1CN1CCN(c2cc(N3CCOCC3)nc(N3CCOCC3)n2)CC1 |
| InChI | InChI=1S/C23H32N6O3/c30-20-4-2-1-3-19(20)18-26-5-7-27(8-6-26)21-17-22(28-9-13-31-14-10-28)25-23(24-21)29-11-15-32-16-12-29/h1-4,17,30H,5-16,18H2 |
| InChIKey | UCAGHBOLXJUKQS-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.55 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|