C21H28N4O3 — CID 158695019
2-[3-(2,6-dimorpholin-4-ylpyrimidin-4-yl)propyl]phenol (PubChem CID 158695019) has the molecular formula C21H28N4O3 and a molecular weight of 384.48 g/mol. Its IUPAC name is 2-[3-(2,6-dimorpholin-4-ylpyrimidin-4-yl)propyl]phenol.
| Compound Name | 2-[3-(2,6-dimorpholin-4-ylpyrimidin-4-yl)propyl]phenol |
|---|---|
| PubChem CID | 158695019 |
| Molecular Formula | C21H28N4O3 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.22 |
| IUPAC Name | 2-[3-(2,6-dimorpholin-4-ylpyrimidin-4-yl)propyl]phenol |
| SMILES | Oc1ccccc1CCCc1cc(N2CCOCC2)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C21H28N4O3/c26-19-7-2-1-4-17(19)5-3-6-18-16-20(24-8-12-27-13-9-24)23-21(22-18)25-10-14-28-15-11-25/h1-2,4,7,16,26H,3,5-6,8-15H2 |
| InChIKey | IGVCFQWWETVXDB-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 70.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |