C21H28N4O2 — CID 135087231
1-(6-ethyl-2-morpholin-4-ylpyrimidin-4-yl)-3-(2-methylphenyl)pyrrolidin-3-ol (PubChem CID 135087231) has the molecular formula C21H28N4O2 and a molecular weight of 368.48 g/mol. Its IUPAC name is 1-(6-ethyl-2-morpholin-4-ylpyrimidin-4-yl)-3-(2-methylphenyl)pyrrolidin-3-ol.
| Compound Name | 1-(6-ethyl-2-morpholin-4-ylpyrimidin-4-yl)-3-(2-methylphenyl)pyrrolidin-3-ol |
|---|---|
| PubChem CID | 135087231 |
| Molecular Formula | C21H28N4O2 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.22 |
| IUPAC Name | 1-(6-ethyl-2-morpholin-4-ylpyrimidin-4-yl)-3-(2-methylphenyl)pyrrolidin-3-ol |
| SMILES | CCc1cc(N2CCC(O)(c3ccccc3C)C2)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C21H28N4O2/c1-3-17-14-19(23-20(22-17)24-10-12-27-13-11-24)25-9-8-21(26,15-25)18-7-5-4-6-16(18)2/h4-7,14,26H,3,8-13,15H2,1-2H3 |
| InChIKey | GNIXXCSTWTYCAH-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |