C18H25N7O2 — CID 50962400
4-[4-(6-ethyl-2-morpholin-4-ylpyrimidin-4-yl)piperazin-1-yl]-1H-pyridazin-6-one (PubChem CID 50962400) has the molecular formula C18H25N7O2 and a molecular weight of 371.45 g/mol. Its IUPAC name is 4-[4-(6-ethyl-2-morpholin-4-ylpyrimidin-4-yl)piperazin-1-yl]-1H-pyridazin-6-one.
| Compound Name | 4-[4-(6-ethyl-2-morpholin-4-ylpyrimidin-4-yl)piperazin-1-yl]-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 50962400 |
| Molecular Formula | C18H25N7O2 |
| Molecular Weight | 371.45 g/mol |
| Exact Mass | 371.21 |
| IUPAC Name | 4-[4-(6-ethyl-2-morpholin-4-ylpyrimidin-4-yl)piperazin-1-yl]-1H-pyridazin-6-one |
| SMILES | CCc1cc(N2CCN(c3cn[nH]c(=O)c3)CC2)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C18H25N7O2/c1-2-14-11-16(21-18(20-14)25-7-9-27-10-8-25)24-5-3-23(4-6-24)15-12-17(26)22-19-13-15/h11-13H,2-10H2,1H3,(H,22,26) |
| InChIKey | KBGFYARLEMNKMV-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 90.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.45 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |