C18H31N3O — CID 68736218
4-(2,6-dipentylpyrimidin-4-yl)morpholine (PubChem CID 68736218) has the molecular formula C18H31N3O and a molecular weight of 305.47 g/mol. Its IUPAC name is 4-(2,6-dipentylpyrimidin-4-yl)morpholine.
| Compound Name | 4-(2,6-dipentylpyrimidin-4-yl)morpholine |
|---|---|
| PubChem CID | 68736218 |
| Molecular Formula | C18H31N3O |
| Molecular Weight | 305.47 g/mol |
| Exact Mass | 305.25 |
| IUPAC Name | 4-(2,6-dipentylpyrimidin-4-yl)morpholine |
| SMILES | CCCCCc1cc(N2CCOCC2)nc(CCCCC)n1 |
| InChI | InChI=1S/C18H31N3O/c1-3-5-7-9-16-15-18(21-11-13-22-14-12-21)20-17(19-16)10-8-6-4-2/h15H,3-14H2,1-2H3 |
| InChIKey | CCCDYCXDYZOACH-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.47 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|