About 2-butyl-4,6-dihexylpyrimidine
2-butyl-4,6-dihexylpyrimidine (PubChem CID 91010912) has the molecular formula C20H36N2
and a molecular weight of 304.52 g/mol. Its IUPAC name is 2-butyl-4,6-dihexylpyrimidine.
Molecular Properties
| Compound Name | 2-butyl-4,6-dihexylpyrimidine |
| PubChem CID | 91010912 |
| Molecular Formula | C20H36N2 |
| Molecular Weight | 304.52 g/mol |
| Exact Mass | 304.29 |
| IUPAC Name | 2-butyl-4,6-dihexylpyrimidine |
| SMILES | CCCCCCc1cc(CCCCCC)nc(CCCC)n1 |
| InChI | InChI=1S/C20H36N2/c1-4-7-10-12-14-18-17-19(15-13-11-8-5-2)22-20(21-18)16-9-6-3/h17H,4-16H2,1-3H3 |
| InChIKey | OXORKMUUUDCBAX-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 304.52 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-butyl-4,6-dihexylpyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butyl-4,6-dihexylpyrimidine?
The IUPAC name of 2-butyl-4,6-dihexylpyrimidine (CID 91010912) is 2-butyl-4,6-dihexylpyrimidine.
What is the SMILES notation for 2-butyl-4,6-dihexylpyrimidine?
The canonical SMILES for 2-butyl-4,6-dihexylpyrimidine is CCCCCCc1cc(CCCCCC)nc(CCCC)n1.
What is the InChIKey of 2-butyl-4,6-dihexylpyrimidine?
The InChIKey is OXORKMUUUDCBAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H36N2/c1-4-7-10-12-14-18-17-19(15-13-11-8-5-2)22-20(21-18)16-9-6-3/h17H,4-16H2,1-3H3.
What are the key properties of 2-butyl-4,6-dihexylpyrimidine?
2-butyl-4,6-dihexylpyrimidine has a molecular weight of 304.52 g/mol, XLogP of 6.06, 13 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butyl-4,6-dihexylpyrimidine is sourced from PubChem (CID 91010912), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).