About 2-methyl-4,6-dioctylpyrimidine
2-methyl-4,6-dioctylpyrimidine (PubChem CID 66935791) has the molecular formula C21H38N2
and a molecular weight of 318.55 g/mol. Its IUPAC name is 2-methyl-4,6-dioctylpyrimidine.
Molecular Properties
| Compound Name | 2-methyl-4,6-dioctylpyrimidine |
| PubChem CID | 66935791 |
| Molecular Formula | C21H38N2 |
| Molecular Weight | 318.55 g/mol |
| Exact Mass | 318.30 |
| IUPAC Name | 2-methyl-4,6-dioctylpyrimidine |
| SMILES | CCCCCCCCc1cc(CCCCCCCC)nc(C)n1 |
| InChI | InChI=1S/C21H38N2/c1-4-6-8-10-12-14-16-20-18-21(23-19(3)22-20)17-15-13-11-9-7-5-2/h18H,4-17H2,1-3H3 |
| InChIKey | HHYUJWYBHLTSHS-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 318.55 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-4,6-dioctylpyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-4,6-dioctylpyrimidine?
The IUPAC name of 2-methyl-4,6-dioctylpyrimidine (CID 66935791) is 2-methyl-4,6-dioctylpyrimidine.
What is the SMILES notation for 2-methyl-4,6-dioctylpyrimidine?
The canonical SMILES for 2-methyl-4,6-dioctylpyrimidine is CCCCCCCCc1cc(CCCCCCCC)nc(C)n1.
What is the InChIKey of 2-methyl-4,6-dioctylpyrimidine?
The InChIKey is HHYUJWYBHLTSHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H38N2/c1-4-6-8-10-12-14-16-20-18-21(23-19(3)22-20)17-15-13-11-9-7-5-2/h18H,4-17H2,1-3H3.
What are the key properties of 2-methyl-4,6-dioctylpyrimidine?
2-methyl-4,6-dioctylpyrimidine has a molecular weight of 318.55 g/mol, XLogP of 6.59, 14 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-4,6-dioctylpyrimidine is sourced from PubChem (CID 66935791), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).