C19H24N6O3 — CID 123459435
2-[diazenyl-(2,6-dimorpholin-4-ylpyrimidin-4-yl)methyl]phenol (PubChem CID 123459435) has the molecular formula C19H24N6O3 and a molecular weight of 384.44 g/mol. Its IUPAC name is 2-[diazenyl-(2,6-dimorpholin-4-ylpyrimidin-4-yl)methyl]phenol.
| Compound Name | 2-[diazenyl-(2,6-dimorpholin-4-ylpyrimidin-4-yl)methyl]phenol |
|---|---|
| PubChem CID | 123459435 |
| Molecular Formula | C19H24N6O3 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | 2-[diazenyl-(2,6-dimorpholin-4-ylpyrimidin-4-yl)methyl]phenol |
| SMILES | [H]/N=N/C(c1cc(N2CCOCC2)nc(N2CCOCC2)n1)c1ccccc1O |
| InChI | InChI=1S/C19H24N6O3/c20-23-18(14-3-1-2-4-16(14)26)15-13-17(24-5-9-27-10-6-24)22-19(21-15)25-7-11-28-12-8-25/h1-4,13,18,20,26H,5-12H2/b23-20+ |
| InChIKey | CRMZAFBMNHEYTQ-BSYVCWPDSA-N |
| XLogP | 1.98 |
| TPSA | 107.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|