C13H17N4O4- — CID 6989309
2,6-dimorpholin-4-ylpyrimidine-4-carboxylate (PubChem CID 6989309) has the molecular formula C13H17N4O4- and a molecular weight of 293.30 g/mol. Its IUPAC name is 2,6-dimorpholin-4-ylpyrimidine-4-carboxylate.
| Compound Name | 2,6-dimorpholin-4-ylpyrimidine-4-carboxylate |
|---|---|
| PubChem CID | 6989309 |
| Molecular Formula | C13H17N4O4- |
| Molecular Weight | 293.30 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | 2,6-dimorpholin-4-ylpyrimidine-4-carboxylate |
| SMILES | O=C([O-])c1cc(N2CCOCC2)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C13H18N4O4/c18-12(19)10-9-11(16-1-5-20-6-2-16)15-13(14-10)17-3-7-21-8-4-17/h9H,1-8H2,(H,18,19)/p-1 |
| InChIKey | PLTAUCRWFSTPNT-UHFFFAOYSA-M |
| XLogP | -1.49 |
| TPSA | 90.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.30 |
| LogP ≤ 5 | -1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |