C15H16N4O3 — CID 143633269
2-(4-aminophenyl)-6-morpholin-4-ylpyrimidine-4-carboxylic acid (PubChem CID 143633269) has the molecular formula C15H16N4O3 and a molecular weight of 300.32 g/mol. Its IUPAC name is 2-(4-aminophenyl)-6-morpholin-4-ylpyrimidine-4-carboxylic acid.
| Compound Name | 2-(4-aminophenyl)-6-morpholin-4-ylpyrimidine-4-carboxylic acid |
|---|---|
| PubChem CID | 143633269 |
| Molecular Formula | C15H16N4O3 |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | 2-(4-aminophenyl)-6-morpholin-4-ylpyrimidine-4-carboxylic acid |
| SMILES | Nc1ccc(-c2nc(C(=O)O)cc(N3CCOCC3)n2)cc1 |
| InChI | InChI=1S/C15H16N4O3/c16-11-3-1-10(2-4-11)14-17-12(15(20)21)9-13(18-14)19-5-7-22-8-6-19/h1-4,9H,5-8,16H2,(H,20,21) |
| InChIKey | PORYIDCWAMLNSJ-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|