C23H25N5OS — CID 143741656
4-[4-morpholin-4-yl-6-(1-pyridin-4-ylsulfanylcyclobutyl)pyrimidin-2-yl]aniline (PubChem CID 143741656) has the molecular formula C23H25N5OS and a molecular weight of 419.55 g/mol. Its IUPAC name is 4-[4-morpholin-4-yl-6-(1-pyridin-4-ylsulfanylcyclobutyl)pyrimidin-2-yl]aniline.
| Compound Name | 4-[4-morpholin-4-yl-6-(1-pyridin-4-ylsulfanylcyclobutyl)pyrimidin-2-yl]aniline |
|---|---|
| PubChem CID | 143741656 |
| Molecular Formula | C23H25N5OS |
| Molecular Weight | 419.55 g/mol |
| Exact Mass | 419.18 |
| IUPAC Name | 4-[4-morpholin-4-yl-6-(1-pyridin-4-ylsulfanylcyclobutyl)pyrimidin-2-yl]aniline |
| SMILES | Nc1ccc(-c2nc(N3CCOCC3)cc(C3(Sc4ccncc4)CCC3)n2)cc1 |
| InChI | InChI=1S/C23H25N5OS/c24-18-4-2-17(3-5-18)22-26-20(16-21(27-22)28-12-14-29-15-13-28)23(8-1-9-23)30-19-6-10-25-11-7-19/h2-7,10-11,16H,1,8-9,12-15,24H2 |
| InChIKey | QWEBTVMNJQRIHO-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 77.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.55 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|