C24H27N5OS — CID 143741508
N-methyl-4-[4-morpholin-4-yl-6-(1-pyridin-2-ylsulfanylcyclobutyl)pyrimidin-2-yl]aniline (PubChem CID 143741508) has the molecular formula C24H27N5OS and a molecular weight of 433.58 g/mol. Its IUPAC name is N-methyl-4-[4-morpholin-4-yl-6-(1-pyridin-2-ylsulfanylcyclobutyl)pyrimidin-2-yl]aniline.
| Compound Name | N-methyl-4-[4-morpholin-4-yl-6-(1-pyridin-2-ylsulfanylcyclobutyl)pyrimidin-2-yl]aniline |
|---|---|
| PubChem CID | 143741508 |
| Molecular Formula | C24H27N5OS |
| Molecular Weight | 433.58 g/mol |
| Exact Mass | 433.19 |
| IUPAC Name | N-methyl-4-[4-morpholin-4-yl-6-(1-pyridin-2-ylsulfanylcyclobutyl)pyrimidin-2-yl]aniline |
| SMILES | CNc1ccc(-c2nc(N3CCOCC3)cc(C3(Sc4ccccn4)CCC3)n2)cc1 |
| InChI | InChI=1S/C24H27N5OS/c1-25-19-8-6-18(7-9-19)23-27-20(17-21(28-23)29-13-15-30-16-14-29)24(10-4-11-24)31-22-5-2-3-12-26-22/h2-3,5-9,12,17,25H,4,10-11,13-16H2,1H3 |
| InChIKey | CAUWIHOJLLDRHF-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 63.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.58 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |