C26H35N5O3S — CID 143741410
1-[4-[4-(1-cyclopropylsulfanylcyclopentyl)-6-morpholin-4-ylpyrimidin-2-yl]phenyl]-3-(3-hydroxypropyl)urea (PubChem CID 143741410) has the molecular formula C26H35N5O3S and a molecular weight of 497.67 g/mol. Its IUPAC name is 1-[4-[4-(1-cyclopropylsulfanylcyclopentyl)-6-morpholin-4-ylpyrimidin-2-yl]phenyl]-3-(3-hydroxypropyl)urea.
| Compound Name | 1-[4-[4-(1-cyclopropylsulfanylcyclopentyl)-6-morpholin-4-ylpyrimidin-2-yl]phenyl]-3-(3-hydroxypropyl)urea |
|---|---|
| PubChem CID | 143741410 |
| Molecular Formula | C26H35N5O3S |
| Molecular Weight | 497.67 g/mol |
| Exact Mass | 497.25 |
| IUPAC Name | 1-[4-[4-(1-cyclopropylsulfanylcyclopentyl)-6-morpholin-4-ylpyrimidin-2-yl]phenyl]-3-(3-hydroxypropyl)urea |
| SMILES | O=C(NCCCO)Nc1ccc(-c2nc(N3CCOCC3)cc(C3(SC4CC4)CCCC3)n2)cc1 |
| InChI | InChI=1S/C26H35N5O3S/c32-15-3-12-27-25(33)28-20-6-4-19(5-7-20)24-29-22(18-23(30-24)31-13-16-34-17-14-31)26(10-1-2-11-26)35-21-8-9-21/h4-7,18,21,32H,1-3,8-17H2,(H2,27,28,33) |
| InChIKey | ZGIOZEGRMFPVID-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 99.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.67 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|