C27H33N5O4S — CID 174603803
1-cyclopropyl-3-[4-[4-[1-(1-cyclopropylprop-2-enylsulfonyl)cyclopropyl]-6-morpholin-4-ylpyrimidin-2-yl]phenyl]urea (PubChem CID 174603803) has the molecular formula C27H33N5O4S and a molecular weight of 523.66 g/mol. Its IUPAC name is 1-cyclopropyl-3-[4-[4-[1-(1-cyclopropylprop-2-enylsulfonyl)cyclopropyl]-6-morpholin-4-ylpyrimidin-2-yl]phenyl]urea.
| Compound Name | 1-cyclopropyl-3-[4-[4-[1-(1-cyclopropylprop-2-enylsulfonyl)cyclopropyl]-6-morpholin-4-ylpyrimidin-2-yl]phenyl]urea |
|---|---|
| PubChem CID | 174603803 |
| Molecular Formula | C27H33N5O4S |
| Molecular Weight | 523.66 g/mol |
| Exact Mass | 523.23 |
| IUPAC Name | 1-cyclopropyl-3-[4-[4-[1-(1-cyclopropylprop-2-enylsulfonyl)cyclopropyl]-6-morpholin-4-ylpyrimidin-2-yl]phenyl]urea |
| SMILES | C=CC(C1CC1)S(=O)(=O)C1(c2cc(N3CCOCC3)nc(-c3ccc(NC(=O)NC4CC4)cc3)n2)CC1 |
| InChI | InChI=1S/C27H33N5O4S/c1-2-22(18-3-4-18)37(34,35)27(11-12-27)23-17-24(32-13-15-36-16-14-32)31-25(30-23)19-5-7-20(8-6-19)28-26(33)29-21-9-10-21/h2,5-8,17-18,21-22H,1,3-4,9-16H2,(H2,28,29,33) |
| InChIKey | SRCJADOPLWFEIU-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 113.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.66 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|