C22H27N5O4S — CID 70273268
1-[4-[4-amino-6-(4-cyclopropylsulfonyloxan-4-yl)pyrimidin-2-yl]phenyl]-3-cyclopropylurea (PubChem CID 70273268) has the molecular formula C22H27N5O4S and a molecular weight of 457.56 g/mol. Its IUPAC name is 1-[4-[4-amino-6-(4-cyclopropylsulfonyloxan-4-yl)pyrimidin-2-yl]phenyl]-3-cyclopropylurea.
| Compound Name | 1-[4-[4-amino-6-(4-cyclopropylsulfonyloxan-4-yl)pyrimidin-2-yl]phenyl]-3-cyclopropylurea |
|---|---|
| PubChem CID | 70273268 |
| Molecular Formula | C22H27N5O4S |
| Molecular Weight | 457.56 g/mol |
| Exact Mass | 457.18 |
| IUPAC Name | 1-[4-[4-amino-6-(4-cyclopropylsulfonyloxan-4-yl)pyrimidin-2-yl]phenyl]-3-cyclopropylurea |
| SMILES | Nc1cc(C2(S(=O)(=O)C3CC3)CCOCC2)nc(-c2ccc(NC(=O)NC3CC3)cc2)n1 |
| InChI | InChI=1S/C22H27N5O4S/c23-19-13-18(22(9-11-31-12-10-22)32(29,30)17-7-8-17)26-20(27-19)14-1-3-15(4-2-14)24-21(28)25-16-5-6-16/h1-4,13,16-17H,5-12H2,(H2,23,26,27)(H2,24,25,28) |
| InChIKey | OTLLPEFERFFIKS-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 136.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.56 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |