C23H25N5O3S — CID 70276349
1-[4-[4-amino-6-[1-(benzenesulfonyl)cyclopropyl]pyrimidin-2-yl]phenyl]-3-propan-2-ylurea (PubChem CID 70276349) has the molecular formula C23H25N5O3S and a molecular weight of 451.55 g/mol. Its IUPAC name is 1-[4-[4-amino-6-[1-(benzenesulfonyl)cyclopropyl]pyrimidin-2-yl]phenyl]-3-propan-2-ylurea.
| Compound Name | 1-[4-[4-amino-6-[1-(benzenesulfonyl)cyclopropyl]pyrimidin-2-yl]phenyl]-3-propan-2-ylurea |
|---|---|
| PubChem CID | 70276349 |
| Molecular Formula | C23H25N5O3S |
| Molecular Weight | 451.55 g/mol |
| Exact Mass | 451.17 |
| IUPAC Name | 1-[4-[4-amino-6-[1-(benzenesulfonyl)cyclopropyl]pyrimidin-2-yl]phenyl]-3-propan-2-ylurea |
| SMILES | CC(C)NC(=O)Nc1ccc(-c2nc(N)cc(C3(S(=O)(=O)c4ccccc4)CC3)n2)cc1 |
| InChI | InChI=1S/C23H25N5O3S/c1-15(2)25-22(29)26-17-10-8-16(9-11-17)21-27-19(14-20(24)28-21)23(12-13-23)32(30,31)18-6-4-3-5-7-18/h3-11,14-15H,12-13H2,1-2H3,(H2,24,27,28)(H2,25,26,29) |
| InChIKey | JYRIFJWKRLUEFF-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 127.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.55 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |