C20H20N6O3S — CID 70274078
1-[4-[4-amino-6-(1-pyridin-2-ylsulfonylcyclopropyl)pyrimidin-2-yl]phenyl]-3-methylurea (PubChem CID 70274078) has the molecular formula C20H20N6O3S and a molecular weight of 424.49 g/mol. Its IUPAC name is 1-[4-[4-amino-6-(1-pyridin-2-ylsulfonylcyclopropyl)pyrimidin-2-yl]phenyl]-3-methylurea.
| Compound Name | 1-[4-[4-amino-6-(1-pyridin-2-ylsulfonylcyclopropyl)pyrimidin-2-yl]phenyl]-3-methylurea |
|---|---|
| PubChem CID | 70274078 |
| Molecular Formula | C20H20N6O3S |
| Molecular Weight | 424.49 g/mol |
| Exact Mass | 424.13 |
| IUPAC Name | 1-[4-[4-amino-6-(1-pyridin-2-ylsulfonylcyclopropyl)pyrimidin-2-yl]phenyl]-3-methylurea |
| SMILES | CNC(=O)Nc1ccc(-c2nc(N)cc(C3(S(=O)(=O)c4ccccn4)CC3)n2)cc1 |
| InChI | InChI=1S/C20H20N6O3S/c1-22-19(27)24-14-7-5-13(6-8-14)18-25-15(12-16(21)26-18)20(9-10-20)30(28,29)17-4-2-3-11-23-17/h2-8,11-12H,9-10H2,1H3,(H2,21,25,26)(H2,22,24,27) |
| InChIKey | LOELFCKOAHUAIN-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 139.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.49 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |