C20H18FN5O3S — CID 70271281
[4-[4-amino-6-[1-(4-fluorophenyl)sulfonylcyclopropyl]pyrimidin-2-yl]phenyl]urea (PubChem CID 70271281) has the molecular formula C20H18FN5O3S and a molecular weight of 427.46 g/mol. Its IUPAC name is [4-[4-amino-6-[1-(4-fluorophenyl)sulfonylcyclopropyl]pyrimidin-2-yl]phenyl]urea.
| Compound Name | [4-[4-amino-6-[1-(4-fluorophenyl)sulfonylcyclopropyl]pyrimidin-2-yl]phenyl]urea |
|---|---|
| PubChem CID | 70271281 |
| Molecular Formula | C20H18FN5O3S |
| Molecular Weight | 427.46 g/mol |
| Exact Mass | 427.11 |
| IUPAC Name | [4-[4-amino-6-[1-(4-fluorophenyl)sulfonylcyclopropyl]pyrimidin-2-yl]phenyl]urea |
| SMILES | NC(=O)Nc1ccc(-c2nc(N)cc(C3(S(=O)(=O)c4ccc(F)cc4)CC3)n2)cc1 |
| InChI | InChI=1S/C20H18FN5O3S/c21-13-3-7-15(8-4-13)30(28,29)20(9-10-20)16-11-17(22)26-18(25-16)12-1-5-14(6-2-12)24-19(23)27/h1-8,11H,9-10H2,(H2,22,25,26)(H3,23,24,27) |
| InChIKey | KTKFWNQMXWVKEB-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 141.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.46 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |